C19H18FN7O2 — CID 22528030
6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitro-N-pyridin-3-ylpyrimidin-4-amine (PubChem CID 22528030) has the molecular formula C19H18FN7O2 and a molecular weight of 395.40 g/mol. Its IUPAC name is 6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitro-N-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | 6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitro-N-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 22528030 |
| Molecular Formula | C19H18FN7O2 |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitro-N-pyridin-3-ylpyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccnc2)ncnc1N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H18FN7O2/c20-15-5-1-2-6-16(15)25-8-10-26(11-9-25)19-17(27(28)29)18(22-13-23-19)24-14-4-3-7-21-12-14/h1-7,12-13H,8-11H2,(H,22,23,24) |
| InChIKey | FLRIWDLDIYLUSJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|