C14H16N6O2 — CID 22528038
4-N-cyclopentyl-5-nitro-6-N-pyridin-3-ylpyrimidine-4,6-diamine (PubChem CID 22528038) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-N-cyclopentyl-5-nitro-6-N-pyridin-3-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-5-nitro-6-N-pyridin-3-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22528038 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-N-cyclopentyl-5-nitro-6-N-pyridin-3-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2cccnc2)ncnc1NC1CCCC1 |
| InChI | InChI=1S/C14H16N6O2/c21-20(22)12-13(18-10-4-1-2-5-10)16-9-17-14(12)19-11-6-3-7-15-8-11/h3,6-10H,1-2,4-5H2,(H2,16,17,18,19) |
| InChIKey | CNIAHPBHCOUANH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|