C15H13FN6O2S — CID 22527683
4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-N-(2-fluorophenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22527683) has the molecular formula C15H13FN6O2S and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-N-(2-fluorophenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-N-(2-fluorophenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22527683 |
| Molecular Formula | C15H13FN6O2S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-N-(2-fluorophenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1nc(Nc2ncnc(Nc3ccccc3F)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C15H13FN6O2S/c1-8-9(2)25-15(19-8)21-14-12(22(23)24)13(17-7-18-14)20-11-6-4-3-5-10(11)16/h3-7H,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | YQLJBVRSRHCOBH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|