C16H14N6O4S — CID 22533997
4-[[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 22533997) has the molecular formula C16H14N6O4S and a molecular weight of 386.39 g/mol. Its IUPAC name is 4-[[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22533997 |
| Molecular Formula | C16H14N6O4S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-[[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1nc(Nc2ncnc(Nc3ccc(C(=O)O)cc3)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C16H14N6O4S/c1-8-9(2)27-16(19-8)21-14-12(22(25)26)13(17-7-18-14)20-11-5-3-10(4-6-11)15(23)24/h3-7H,1-2H3,(H,23,24)(H2,17,18,19,20,21) |
| InChIKey | JGTWLUURQIMUMI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 143.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|