C21H17N5O8 — CID 23486438
4-[[6-[3,5-bis(methoxycarbonyl)anilino]-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 23486438) has the molecular formula C21H17N5O8 and a molecular weight of 467.39 g/mol. Its IUPAC name is 4-[[6-[3,5-bis(methoxycarbonyl)anilino]-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[3,5-bis(methoxycarbonyl)anilino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 23486438 |
| Molecular Formula | C21H17N5O8 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 4-[[6-[3,5-bis(methoxycarbonyl)anilino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | COC(=O)c1cc(Nc2ncnc(Nc3ccc(C(=O)O)cc3)c2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H17N5O8/c1-33-20(29)12-7-13(21(30)34-2)9-15(8-12)25-18-16(26(31)32)17(22-10-23-18)24-14-5-3-11(4-6-14)19(27)28/h3-10H,1-2H3,(H,27,28)(H2,22,23,24,25) |
| InChIKey | NGXFHZJHJCUHNN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 182.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|