C11H10N6O4 — CID 22534779
4-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]benzoic acid (PubChem CID 22534779) has the molecular formula C11H10N6O4 and a molecular weight of 290.24 g/mol. Its IUPAC name is 4-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 4-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 22534779 |
| Molecular Formula | C11H10N6O4 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]benzoic acid |
| SMILES | NNc1ncnc(Nc2ccc(C(=O)O)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N6O4/c12-16-10-8(17(20)21)9(13-5-14-10)15-7-3-1-6(2-4-7)11(18)19/h1-5H,12H2,(H,18,19)(H2,13,14,15,16) |
| InChIKey | XMDOFABSRRGUPX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|