C15H18N6O4 — CID 22537571
4-[[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 22537571) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is 4-[[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22537571 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-[[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | CC(C)(C)NNc1ncnc(Nc2ccc(C(=O)O)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N6O4/c1-15(2,3)20-19-13-11(21(24)25)12(16-8-17-13)18-10-6-4-9(5-7-10)14(22)23/h4-8,20H,1-3H3,(H,22,23)(H2,16,17,18,19) |
| InChIKey | OIGZMQNQDJDMLO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|