C17H24N6O2 — CID 23486602
6-(2-tert-butylhydrazinyl)-5-nitro-N-(4-propan-2-ylphenyl)pyrimidin-4-amine (PubChem CID 23486602) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 6-(2-tert-butylhydrazinyl)-5-nitro-N-(4-propan-2-ylphenyl)pyrimidin-4-amine.
| Compound Name | 6-(2-tert-butylhydrazinyl)-5-nitro-N-(4-propan-2-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23486602 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 6-(2-tert-butylhydrazinyl)-5-nitro-N-(4-propan-2-ylphenyl)pyrimidin-4-amine |
| SMILES | CC(C)c1ccc(Nc2ncnc(NNC(C)(C)C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H24N6O2/c1-11(2)12-6-8-13(9-7-12)20-15-14(23(24)25)16(19-10-18-15)21-22-17(3,4)5/h6-11,22H,1-5H3,(H2,18,19,20,21) |
| InChIKey | YGEWCWJBENZBJS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|