C14H17BrN6O2 — CID 22533105
N-(4-bromophenyl)-6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-amine (PubChem CID 22533105) has the molecular formula C14H17BrN6O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is N-(4-bromophenyl)-6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(4-bromophenyl)-6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22533105 |
| Molecular Formula | C14H17BrN6O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-(4-bromophenyl)-6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-amine |
| SMILES | CC(C)(C)NNc1ncnc(Nc2ccc(Br)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17BrN6O2/c1-14(2,3)20-19-13-11(21(22)23)12(16-8-17-13)18-10-6-4-9(15)5-7-10/h4-8,20H,1-3H3,(H2,16,17,18,19) |
| InChIKey | PZRVUJHRLOVCFA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|