C21H15N5O4 — CID 22527627
4-[[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 22527627) has the molecular formula C21H15N5O4 and a molecular weight of 401.38 g/mol. Its IUPAC name is 4-[[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22527627 |
| Molecular Formula | C21H15N5O4 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-[[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncnc(Nc3cccc4ccccc34)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H15N5O4/c27-21(28)14-8-10-15(11-9-14)24-19-18(26(29)30)20(23-12-22-19)25-17-7-3-5-13-4-1-2-6-16(13)17/h1-12H,(H,27,28)(H2,22,23,24,25) |
| InChIKey | DZEWPYCYRYQHAJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|