C17H12N6O2S — CID 22527520
6-N-naphthalen-1-yl-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine (PubChem CID 22527520) has the molecular formula C17H12N6O2S and a molecular weight of 364.39 g/mol. Its IUPAC name is 6-N-naphthalen-1-yl-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-naphthalen-1-yl-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22527520 |
| Molecular Formula | C17H12N6O2S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 6-N-naphthalen-1-yl-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2nccs2)ncnc1Nc1cccc2ccccc12 |
| InChI | InChI=1S/C17H12N6O2S/c24-23(25)14-15(19-10-20-16(14)22-17-18-8-9-26-17)21-13-7-3-5-11-4-1-2-6-12(11)13/h1-10H,(H2,18,19,20,21,22) |
| InChIKey | CZVWZIURQPDBLY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|