C7H7N7O2S — CID 22531681
N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1,3-thiazol-2-amine (PubChem CID 22531681) has the molecular formula C7H7N7O2S and a molecular weight of 253.25 g/mol. Its IUPAC name is N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 22531681 |
| Molecular Formula | C7H7N7O2S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1,3-thiazol-2-amine |
| SMILES | NNc1ncnc(Nc2nccs2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N7O2S/c8-13-6-4(14(15)16)5(10-3-11-6)12-7-9-1-2-17-7/h1-3H,8H2,(H2,9,10,11,12,13) |
| InChIKey | VCOOHQXSQPVEKT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|