C12H16N8O2S — CID 22526349
4-N-(4-methylpiperazin-1-yl)-5-nitro-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine (PubChem CID 22526349) has the molecular formula C12H16N8O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 4-N-(4-methylpiperazin-1-yl)-5-nitro-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-methylpiperazin-1-yl)-5-nitro-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526349 |
| Molecular Formula | C12H16N8O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-N-(4-methylpiperazin-1-yl)-5-nitro-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
| SMILES | CN1CCN(Nc2ncnc(Nc3nccs3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H16N8O2S/c1-18-3-5-19(6-4-18)17-11-9(20(21)22)10(14-8-15-11)16-12-13-2-7-23-12/h2,7-8H,3-6H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | HIPCFRNZXSRYBZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|