C15H19N9O3 — CID 22526399
N'-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide (PubChem CID 22526399) has the molecular formula C15H19N9O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is N'-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 22526399 |
| Molecular Formula | C15H19N9O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N'-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide |
| SMILES | CN1CCN(Nc2ncnc(NNC(=O)c3ccncc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H19N9O3/c1-22-6-8-23(9-7-22)21-14-12(24(26)27)13(17-10-18-14)19-20-15(25)11-2-4-16-5-3-11/h2-5,10H,6-9H2,1H3,(H,20,25)(H2,17,18,19,21) |
| InChIKey | YBCUUJYTQHDHHB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|