C15H17Cl2N7O2 — CID 22526342
6-N-(2,5-dichlorophenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22526342) has the molecular formula C15H17Cl2N7O2 and a molecular weight of 398.25 g/mol. Its IUPAC name is 6-N-(2,5-dichlorophenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2,5-dichlorophenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526342 |
| Molecular Formula | C15H17Cl2N7O2 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 6-N-(2,5-dichlorophenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CN1CCN(Nc2ncnc(Nc3cc(Cl)ccc3Cl)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H17Cl2N7O2/c1-22-4-6-23(7-5-22)21-15-13(24(25)26)14(18-9-19-15)20-12-8-10(16)2-3-11(12)17/h2-3,8-9H,4-7H2,1H3,(H2,18,19,20,21) |
| InChIKey | AUMARIBEAWIQIU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|