C15H18IN7O2 — CID 22526362
6-N-(4-iodophenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22526362) has the molecular formula C15H18IN7O2 and a molecular weight of 455.26 g/mol. Its IUPAC name is 6-N-(4-iodophenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-iodophenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526362 |
| Molecular Formula | C15H18IN7O2 |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 6-N-(4-iodophenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CN1CCN(Nc2ncnc(Nc3ccc(I)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H18IN7O2/c1-21-6-8-22(9-7-21)20-15-13(23(24)25)14(17-10-18-15)19-12-4-2-11(16)3-5-12/h2-5,10H,6-9H2,1H3,(H2,17,18,19,20) |
| InChIKey | CDPOLWFUHVZELK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|