C19H25IN6O2 — CID 22528376
6-N-(4-iodophenyl)-5-nitro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 22528376) has the molecular formula C19H25IN6O2 and a molecular weight of 496.35 g/mol. Its IUPAC name is 6-N-(4-iodophenyl)-5-nitro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-iodophenyl)-5-nitro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22528376 |
| Molecular Formula | C19H25IN6O2 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 6-N-(4-iodophenyl)-5-nitro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | CC1(C)CC(Nc2ncnc(Nc3ccc(I)cc3)c2[N+](=O)[O-])CC(C)(C)N1 |
| InChI | InChI=1S/C19H25IN6O2/c1-18(2)9-14(10-19(3,4)25-18)24-17-15(26(27)28)16(21-11-22-17)23-13-7-5-12(20)6-8-13/h5-8,11,14,25H,9-10H2,1-4H3,(H2,21,22,23,24) |
| InChIKey | WUODOZCVTJTBPL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|