C22H27N7O2 — CID 22528430
5-nitro-6-N-quinolin-5-yl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 22528430) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 5-nitro-6-N-quinolin-5-yl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-6-N-quinolin-5-yl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22528430 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 5-nitro-6-N-quinolin-5-yl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | CC1(C)CC(Nc2ncnc(Nc3cccc4ncccc34)c2[N+](=O)[O-])CC(C)(C)N1 |
| InChI | InChI=1S/C22H27N7O2/c1-21(2)11-14(12-22(3,4)28-21)26-19-18(29(30)31)20(25-13-24-19)27-17-9-5-8-16-15(17)7-6-10-23-16/h5-10,13-14,28H,11-12H2,1-4H3,(H2,24,25,26,27) |
| InChIKey | AXZDANCZWFBSFF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|