C20H35N7O2 — CID 22526030
5-nitro-6-N-(2-piperidin-1-ylethyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 22526030) has the molecular formula C20H35N7O2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 5-nitro-6-N-(2-piperidin-1-ylethyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-6-N-(2-piperidin-1-ylethyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526030 |
| Molecular Formula | C20H35N7O2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 5-nitro-6-N-(2-piperidin-1-ylethyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | CC1(C)CC(Nc2ncnc(NCCN3CCCCC3)c2[N+](=O)[O-])CC(C)(C)N1 |
| InChI | InChI=1S/C20H35N7O2/c1-19(2)12-15(13-20(3,4)25-19)24-18-16(27(28)29)17(22-14-23-18)21-8-11-26-9-6-5-7-10-26/h14-15,25H,5-13H2,1-4H3,(H2,21,22,23,24) |
| InChIKey | JOGCBIYCSDBSMT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|