C18H25N7O4S — CID 22526100
4-methyl-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzenesulfonohydrazide (PubChem CID 22526100) has the molecular formula C18H25N7O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 4-methyl-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzenesulfonohydrazide.
| Compound Name | 4-methyl-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 22526100 |
| Molecular Formula | C18H25N7O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-methyl-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(NCCN3CCCCC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H25N7O4S/c1-14-5-7-15(8-6-14)30(28,29)23-22-18-16(25(26)27)17(20-13-21-18)19-9-12-24-10-3-2-4-11-24/h5-8,13,23H,2-4,9-12H2,1H3,(H2,19,20,21,22) |
| InChIKey | IPJVGROYVCELNA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|