C19H20N6O4S — CID 23484915
N'-[6-(3,4-dimethylanilino)-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 23484915) has the molecular formula C19H20N6O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is N'-[6-(3,4-dimethylanilino)-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[6-(3,4-dimethylanilino)-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 23484915 |
| Molecular Formula | C19H20N6O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N'-[6-(3,4-dimethylanilino)-5-nitropyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(Nc3ccc(C)c(C)c3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N6O4S/c1-12-4-8-16(9-5-12)30(28,29)24-23-19-17(25(26)27)18(20-11-21-19)22-15-7-6-13(2)14(3)10-15/h4-11,24H,1-3H3,(H2,20,21,22,23) |
| InChIKey | IQYZXKLNKHXYLY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|