C16H15N7O6S2 — CID 101253878
N'-[6-[2-(benzenesulfonyl)hydrazinyl]-5-nitropyrimidin-4-yl]benzenesulfonohydrazide (PubChem CID 101253878) has the molecular formula C16H15N7O6S2 and a molecular weight of 465.47 g/mol. Its IUPAC name is N'-[6-[2-(benzenesulfonyl)hydrazinyl]-5-nitropyrimidin-4-yl]benzenesulfonohydrazide.
| Compound Name | N'-[6-[2-(benzenesulfonyl)hydrazinyl]-5-nitropyrimidin-4-yl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 101253878 |
| Molecular Formula | C16H15N7O6S2 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N'-[6-[2-(benzenesulfonyl)hydrazinyl]-5-nitropyrimidin-4-yl]benzenesulfonohydrazide |
| SMILES | O=[N+]([O-])c1c(NNS(=O)(=O)c2ccccc2)ncnc1NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15N7O6S2/c24-23(25)14-15(19-21-30(26,27)12-7-3-1-4-8-12)17-11-18-16(14)20-22-31(28,29)13-9-5-2-6-10-13/h1-11,21-22H,(H2,17,18,19,20) |
| InChIKey | QBZZUPCJWALGBV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 185.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|