C16H14N8O4 — CID 22526624
1-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]-2-phenylhydrazine (PubChem CID 22526624) has the molecular formula C16H14N8O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is 1-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]-2-phenylhydrazine.
| Compound Name | 1-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 22526624 |
| Molecular Formula | C16H14N8O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]-2-phenylhydrazine |
| SMILES | O=[N+]([O-])c1ccc(NNc2ncnc(NNc3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14N8O4/c25-23(26)13-8-6-12(7-9-13)20-22-16-14(24(27)28)15(17-10-18-16)21-19-11-4-2-1-3-5-11/h1-10,19-20H,(H2,17,18,21,22) |
| InChIKey | LJFRJQSWVIWLNI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 160.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|