C14H17N7O4 — CID 22526890
N-butan-2-yl-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine (PubChem CID 22526890) has the molecular formula C14H17N7O4 and a molecular weight of 347.34 g/mol. Its IUPAC name is N-butan-2-yl-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine.
| Compound Name | N-butan-2-yl-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22526890 |
| Molecular Formula | C14H17N7O4 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-butan-2-yl-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine |
| SMILES | CCC(C)Nc1ncnc(NNc2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N7O4/c1-3-9(2)17-13-12(21(24)25)14(16-8-15-13)19-18-10-4-6-11(7-5-10)20(22)23/h4-9,18H,3H2,1-2H3,(H2,15,16,17,19) |
| InChIKey | XCXICBYZGKVPHH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|