C17H13F3N6O2 — CID 22526736
5-nitro-6-(2-phenylhydrazinyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 22526736) has the molecular formula C17H13F3N6O2 and a molecular weight of 390.33 g/mol. Its IUPAC name is 5-nitro-6-(2-phenylhydrazinyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-nitro-6-(2-phenylhydrazinyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22526736 |
| Molecular Formula | C17H13F3N6O2 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 5-nitro-6-(2-phenylhydrazinyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NNc2ccccc2)ncnc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N6O2/c18-17(19,20)11-6-8-12(9-7-11)23-15-14(26(27)28)16(22-10-21-15)25-24-13-4-2-1-3-5-13/h1-10,24H,(H2,21,22,23,25) |
| InChIKey | FFUNAXWMGWPERY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|