C13H13F3N6O2 — CID 22528173
6-(2,2-dimethylhydrazinyl)-5-nitro-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 22528173) has the molecular formula C13H13F3N6O2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 6-(2,2-dimethylhydrazinyl)-5-nitro-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-(2,2-dimethylhydrazinyl)-5-nitro-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22528173 |
| Molecular Formula | C13H13F3N6O2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 6-(2,2-dimethylhydrazinyl)-5-nitro-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CN(C)Nc1ncnc(Nc2ccc(C(F)(F)F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13F3N6O2/c1-21(2)20-12-10(22(23)24)11(17-7-18-12)19-9-5-3-8(4-6-9)13(14,15)16/h3-7H,1-2H3,(H2,17,18,19,20) |
| InChIKey | YPRYBSZBQURSRO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|