C13H16N6O3 — CID 23482431
6-(2,2-dimethylhydrazinyl)-N-(3-methoxyphenyl)-5-nitropyrimidin-4-amine (PubChem CID 23482431) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 6-(2,2-dimethylhydrazinyl)-N-(3-methoxyphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(2,2-dimethylhydrazinyl)-N-(3-methoxyphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23482431 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6-(2,2-dimethylhydrazinyl)-N-(3-methoxyphenyl)-5-nitropyrimidin-4-amine |
| SMILES | COc1cccc(Nc2ncnc(NN(C)C)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N6O3/c1-18(2)17-13-11(19(20)21)12(14-8-15-13)16-9-5-4-6-10(7-9)22-3/h4-8H,1-3H3,(H2,14,15,16,17) |
| InChIKey | BRERKXYUGHIDEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|