C15H14N6O4 — CID 23478871
6-N-(3-methoxyphenyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23478871) has the molecular formula C15H14N6O4 and a molecular weight of 342.32 g/mol. Its IUPAC name is 6-N-(3-methoxyphenyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-methoxyphenyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23478871 |
| Molecular Formula | C15H14N6O4 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 6-N-(3-methoxyphenyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1cccc(Nc2ncnc(Nc3cc(C)on3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N6O4/c1-9-6-12(20-25-9)19-15-13(21(22)23)14(16-8-17-15)18-10-4-3-5-11(7-10)24-2/h3-8H,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | FUDRDPDFUAIDES-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|