C13H11N7O3 — CID 23478869
4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-6-N-pyridin-4-ylpyrimidine-4,6-diamine (PubChem CID 23478869) has the molecular formula C13H11N7O3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-6-N-pyridin-4-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-6-N-pyridin-4-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23478869 |
| Molecular Formula | C13H11N7O3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-6-N-pyridin-4-ylpyrimidine-4,6-diamine |
| SMILES | Cc1cc(Nc2ncnc(Nc3ccncc3)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C13H11N7O3/c1-8-6-10(19-23-8)18-13-11(20(21)22)12(15-7-16-13)17-9-2-4-14-5-3-9/h2-7H,1H3,(H2,14,15,16,17,18,19) |
| InChIKey | KLARMRBOMSGWMB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|