C11H9N7O3S — CID 23478973
6-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine (PubChem CID 23478973) has the molecular formula C11H9N7O3S and a molecular weight of 319.31 g/mol. Its IUPAC name is 6-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23478973 |
| Molecular Formula | C11H9N7O3S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 6-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
| SMILES | Cc1cc(Nc2ncnc(Nc3nccs3)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C11H9N7O3S/c1-6-4-7(17-21-6)15-9-8(18(19)20)10(14-5-13-9)16-11-12-2-3-22-11/h2-5H,1H3,(H2,12,13,14,15,16,17) |
| InChIKey | IUYSWWQCWLVZME-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|