C13H9ClN6O2S — CID 22531660
6-N-(3-chlorophenyl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine (PubChem CID 22531660) has the molecular formula C13H9ClN6O2S and a molecular weight of 348.78 g/mol. Its IUPAC name is 6-N-(3-chlorophenyl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-chlorophenyl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22531660 |
| Molecular Formula | C13H9ClN6O2S |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 6-N-(3-chlorophenyl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(Cl)c2)ncnc1Nc1nccs1 |
| InChI | InChI=1S/C13H9ClN6O2S/c14-8-2-1-3-9(6-8)18-11-10(20(21)22)12(17-7-16-11)19-13-15-4-5-23-13/h1-7H,(H2,15,16,17,18,19) |
| InChIKey | BPYHOBNQODQZEC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|