C14H12N6O3S — CID 22531668
6-N-(4-methoxyphenyl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine (PubChem CID 22531668) has the molecular formula C14H12N6O3S and a molecular weight of 344.36 g/mol. Its IUPAC name is 6-N-(4-methoxyphenyl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-methoxyphenyl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22531668 |
| Molecular Formula | C14H12N6O3S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 6-N-(4-methoxyphenyl)-5-nitro-4-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2ncnc(Nc3nccs3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12N6O3S/c1-23-10-4-2-9(3-5-10)18-12-11(20(21)22)13(17-8-16-12)19-14-15-6-7-24-14/h2-8H,1H3,(H2,15,16,17,18,19) |
| InChIKey | BTFTWAORVWBASS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|