C16H14N6O5 — CID 23478991
methyl 4-[[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 23478991) has the molecular formula C16H14N6O5 and a molecular weight of 370.33 g/mol. Its IUPAC name is methyl 4-[[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 23478991 |
| Molecular Formula | C16H14N6O5 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | methyl 4-[[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc(Nc3cc(C)on3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14N6O5/c1-9-7-12(21-27-9)20-15-13(22(24)25)14(17-8-18-15)19-11-5-3-10(4-6-11)16(23)26-2/h3-8H,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | KINPKSSNQKRBHS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 145.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|