C19H16N4O5 — CID 22533746
methyl 4-[[6-(4-methylphenoxy)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22533746) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is methyl 4-[[6-(4-methylphenoxy)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-(4-methylphenoxy)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22533746 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | methyl 4-[[6-(4-methylphenoxy)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc(Oc3ccc(C)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N4O5/c1-12-3-9-15(10-4-12)28-18-16(23(25)26)17(20-11-21-18)22-14-7-5-13(6-8-14)19(24)27-2/h3-11H,1-2H3,(H,20,21,22) |
| InChIKey | UMYGMYRLWSRGAM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|