C18H13F3N4O4 — CID 22537434
6-(4-methylphenoxy)-5-nitro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine (PubChem CID 22537434) has the molecular formula C18H13F3N4O4 and a molecular weight of 406.32 g/mol. Its IUPAC name is 6-(4-methylphenoxy)-5-nitro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine.
| Compound Name | 6-(4-methylphenoxy)-5-nitro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22537434 |
| Molecular Formula | C18H13F3N4O4 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 6-(4-methylphenoxy)-5-nitro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| SMILES | Cc1ccc(Oc2ncnc(Nc3ccc(OC(F)(F)F)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13F3N4O4/c1-11-2-6-13(7-3-11)28-17-15(25(26)27)16(22-10-23-17)24-12-4-8-14(9-5-12)29-18(19,20)21/h2-10H,1H3,(H,22,23,24) |
| InChIKey | LTHNVUFJORYISS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|