C19H18N4O4 — CID 22533536
N-(4-ethoxyphenyl)-6-(4-methylphenoxy)-5-nitropyrimidin-4-amine (PubChem CID 22533536) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-6-(4-methylphenoxy)-5-nitropyrimidin-4-amine.
| Compound Name | N-(4-ethoxyphenyl)-6-(4-methylphenoxy)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22533536 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-6-(4-methylphenoxy)-5-nitropyrimidin-4-amine |
| SMILES | CCOc1ccc(Nc2ncnc(Oc3ccc(C)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N4O4/c1-3-26-15-10-6-14(7-11-15)22-18-17(23(24)25)19(21-12-20-18)27-16-8-4-13(2)5-9-16/h4-12H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | YMLVYRMZRMYPSW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|