C17H13IN4O4 — CID 22533263
N-(4-iodophenyl)-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine (PubChem CID 22533263) has the molecular formula C17H13IN4O4 and a molecular weight of 464.22 g/mol. Its IUPAC name is N-(4-iodophenyl)-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine.
| Compound Name | N-(4-iodophenyl)-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22533263 |
| Molecular Formula | C17H13IN4O4 |
| Molecular Weight | 464.22 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | N-(4-iodophenyl)-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(Oc2ncnc(Nc3ccc(I)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13IN4O4/c1-25-13-6-8-14(9-7-13)26-17-15(22(23)24)16(19-10-20-17)21-12-4-2-11(18)3-5-12/h2-10H,1H3,(H,19,20,21) |
| InChIKey | RAVKVTKEHYQRQL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.22 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|