C17H12ClFN4O4 — CID 22537904
N-(3-chloro-4-fluorophenyl)-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine (PubChem CID 22537904) has the molecular formula C17H12ClFN4O4 and a molecular weight of 390.76 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22537904 |
| Molecular Formula | C17H12ClFN4O4 |
| Molecular Weight | 390.76 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(Oc2ncnc(Nc3ccc(F)c(Cl)c3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12ClFN4O4/c1-26-11-3-5-12(6-4-11)27-17-15(23(24)25)16(20-9-21-17)22-10-2-7-14(19)13(18)8-10/h2-9H,1H3,(H,20,21,22) |
| InChIKey | QTDSFZDSNZSLII-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.76 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|