C18H12ClF3N4O4 — CID 23479800
N-[2-chloro-5-(trifluoromethyl)phenyl]-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine (PubChem CID 23479800) has the molecular formula C18H12ClF3N4O4 and a molecular weight of 440.77 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23479800 |
| Molecular Formula | C18H12ClF3N4O4 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-6-(4-methoxyphenoxy)-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(Oc2ncnc(Nc3cc(C(F)(F)F)ccc3Cl)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12ClF3N4O4/c1-29-11-3-5-12(6-4-11)30-17-15(26(27)28)16(23-9-24-17)25-14-8-10(18(20,21)22)2-7-13(14)19/h2-9H,1H3,(H,23,24,25) |
| InChIKey | ZOYJUZHIMVPQQO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|