C22H20ClF3N6O3 — CID 23479626
N-[2-chloro-5-(trifluoromethyl)phenyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 23479626) has the molecular formula C22H20ClF3N6O3 and a molecular weight of 508.89 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23479626 |
| Molecular Formula | C22H20ClF3N6O3 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Nc4cc(C(F)(F)F)ccc4Cl)c3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C22H20ClF3N6O3/c1-35-16-5-3-15(4-6-16)30-8-10-31(11-9-30)21-19(32(33)34)20(27-13-28-21)29-18-12-14(22(24,25)26)2-7-17(18)23/h2-7,12-13H,8-11H2,1H3,(H,27,28,29) |
| InChIKey | UKXZDVXLCYNCHQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|