C22H22ClF3N6O — CID 22541156
4-N-[2-chloro-5-(trifluoromethyl)phenyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine (PubChem CID 22541156) has the molecular formula C22H22ClF3N6O and a molecular weight of 478.91 g/mol. Its IUPAC name is 4-N-[2-chloro-5-(trifluoromethyl)phenyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine.
| Compound Name | 4-N-[2-chloro-5-(trifluoromethyl)phenyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22541156 |
| Molecular Formula | C22H22ClF3N6O |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 4-N-[2-chloro-5-(trifluoromethyl)phenyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Nc4cc(C(F)(F)F)ccc4Cl)c3N)CC2)cc1 |
| InChI | InChI=1S/C22H22ClF3N6O/c1-33-16-5-3-15(4-6-16)31-8-10-32(11-9-31)21-19(27)20(28-13-29-21)30-18-12-14(22(24,25)26)2-7-17(18)23/h2-7,12-13H,8-11,27H2,1H3,(H,28,29,30) |
| InChIKey | VHKDOOAXSMEKIK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|