C23H27ClN6O3 — CID 19139002
4-N-(5-chloro-2,4-dimethoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine (PubChem CID 19139002) has the molecular formula C23H27ClN6O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is 4-N-(5-chloro-2,4-dimethoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine.
| Compound Name | 4-N-(5-chloro-2,4-dimethoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19139002 |
| Molecular Formula | C23H27ClN6O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 4-N-(5-chloro-2,4-dimethoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Nc4cc(Cl)c(OC)cc4OC)c3N)CC2)cc1 |
| InChI | InChI=1S/C23H27ClN6O3/c1-31-16-6-4-15(5-7-16)29-8-10-30(11-9-29)23-21(25)22(26-14-27-23)28-18-12-17(24)19(32-2)13-20(18)33-3/h4-7,12-14H,8-11,25H2,1-3H3,(H,26,27,28) |
| InChIKey | WEFIEDUQNOURBW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|