C27H29N7O — CID 19138923
4-(2,2-diphenylhydrazinyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-5-amine (PubChem CID 19138923) has the molecular formula C27H29N7O and a molecular weight of 467.58 g/mol. Its IUPAC name is 4-(2,2-diphenylhydrazinyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-5-amine.
| Compound Name | 4-(2,2-diphenylhydrazinyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 19138923 |
| Molecular Formula | C27H29N7O |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4-(2,2-diphenylhydrazinyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-5-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(NN(c4ccccc4)c4ccccc4)c3N)CC2)cc1 |
| InChI | InChI=1S/C27H29N7O/c1-35-24-14-12-21(13-15-24)32-16-18-33(19-17-32)27-25(28)26(29-20-30-27)31-34(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-15,20H,16-19,28H2,1H3,(H,29,30,31) |
| InChIKey | SKFIYDHJMFULAG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|