C23H26N6O2 — CID 19146669
methyl 1-[5-amino-6-(2,2-diphenylhydrazinyl)pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 19146669) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is methyl 1-[5-amino-6-(2,2-diphenylhydrazinyl)pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-amino-6-(2,2-diphenylhydrazinyl)pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19146669 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | methyl 1-[5-amino-6-(2,2-diphenylhydrazinyl)pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(NN(c3ccccc3)c3ccccc3)c2N)CC1 |
| InChI | InChI=1S/C23H26N6O2/c1-31-23(30)17-12-14-28(15-13-17)22-20(24)21(25-16-26-22)27-29(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,16-17H,12-15,24H2,1H3,(H,25,26,27) |
| InChIKey | YVYZCNBGEHMJNP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|