C17H20FN5O2 — CID 19149063
methyl 1-[5-amino-6-(4-fluoroanilino)pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 19149063) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is methyl 1-[5-amino-6-(4-fluoroanilino)pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-amino-6-(4-fluoroanilino)pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19149063 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | methyl 1-[5-amino-6-(4-fluoroanilino)pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(Nc3ccc(F)cc3)c2N)CC1 |
| InChI | InChI=1S/C17H20FN5O2/c1-25-17(24)11-6-8-23(9-7-11)16-14(19)15(20-10-21-16)22-13-4-2-12(18)3-5-13/h2-5,10-11H,6-9,19H2,1H3,(H,20,21,22) |
| InChIKey | HTLAZKPRIPIAMW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |