C18H22IN5O2 — CID 19142097
ethyl 1-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 19142097) has the molecular formula C18H22IN5O2 and a molecular weight of 467.31 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19142097 |
| Molecular Formula | C18H22IN5O2 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | ethyl 1-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Nc3ccc(I)cc3)c2N)CC1 |
| InChI | InChI=1S/C18H22IN5O2/c1-2-26-18(25)12-7-9-24(10-8-12)17-15(20)16(21-11-22-17)23-14-5-3-13(19)4-6-14/h3-6,11-12H,2,7-10,20H2,1H3,(H,21,22,23) |
| InChIKey | SQJBFAZJCBDDMW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|