C19H24ClN5O2 — CID 19142114
ethyl 1-[5-amino-6-[(4-chlorophenyl)methylamino]pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 19142114) has the molecular formula C19H24ClN5O2 and a molecular weight of 389.89 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-[(4-chlorophenyl)methylamino]pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-[(4-chlorophenyl)methylamino]pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19142114 |
| Molecular Formula | C19H24ClN5O2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl 1-[5-amino-6-[(4-chlorophenyl)methylamino]pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(NCc3ccc(Cl)cc3)c2N)CC1 |
| InChI | InChI=1S/C19H24ClN5O2/c1-2-27-19(26)14-7-9-25(10-8-14)18-16(21)17(23-12-24-18)22-11-13-3-5-15(20)6-4-13/h3-6,12,14H,2,7-11,21H2,1H3,(H,22,23,24) |
| InChIKey | ADIUOSRVDKCVFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |