C16H20IN5 — CID 19137872
6-(azepan-1-yl)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine (PubChem CID 19137872) has the molecular formula C16H20IN5 and a molecular weight of 409.28 g/mol. Its IUPAC name is 6-(azepan-1-yl)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(azepan-1-yl)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19137872 |
| Molecular Formula | C16H20IN5 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 6-(azepan-1-yl)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccc(I)cc2)ncnc1N1CCCCCC1 |
| InChI | InChI=1S/C16H20IN5/c17-12-5-7-13(8-6-12)21-15-14(18)16(20-11-19-15)22-9-3-1-2-4-10-22/h5-8,11H,1-4,9-10,18H2,(H,19,20,21) |
| InChIKey | SGUJXRUWGCJRKQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|