C19H27N5 — CID 22547783
6-(azepan-1-yl)-4-N-(4-propan-2-ylphenyl)pyrimidine-4,5-diamine (PubChem CID 22547783) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is 6-(azepan-1-yl)-4-N-(4-propan-2-ylphenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(azepan-1-yl)-4-N-(4-propan-2-ylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22547783 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 6-(azepan-1-yl)-4-N-(4-propan-2-ylphenyl)pyrimidine-4,5-diamine |
| SMILES | CC(C)c1ccc(Nc2ncnc(N3CCCCCC3)c2N)cc1 |
| InChI | InChI=1S/C19H27N5/c1-14(2)15-7-9-16(10-8-15)23-18-17(20)19(22-13-21-18)24-11-5-3-4-6-12-24/h7-10,13-14H,3-6,11-12,20H2,1-2H3,(H,21,22,23) |
| InChIKey | BYFIGKNHBDEQQM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |