C20H29N5O — CID 19137826
6-(azepan-1-yl)-4-N-(4-butoxyphenyl)pyrimidine-4,5-diamine (PubChem CID 19137826) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 6-(azepan-1-yl)-4-N-(4-butoxyphenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(azepan-1-yl)-4-N-(4-butoxyphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19137826 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 6-(azepan-1-yl)-4-N-(4-butoxyphenyl)pyrimidine-4,5-diamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(N3CCCCCC3)c2N)cc1 |
| InChI | InChI=1S/C20H29N5O/c1-2-3-14-26-17-10-8-16(9-11-17)24-19-18(21)20(23-15-22-19)25-12-6-4-5-7-13-25/h8-11,15H,2-7,12-14,21H2,1H3,(H,22,23,24) |
| InChIKey | ZLHWCNSKGKDAQK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|